3-(2,3-Dichlorophenyl)propanoic acid, 97%
cas: 57915-79-4 — see every product listed under this CAS number, including other names
3-(2,3-Dichlorophenyl)propanoic acid, 97% (CAS 57915-79-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A110689-250mg |
| cas | 57915-79-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 331.44 Pln | |
| Ambeed | 25g | 704.12 Pln | |
| Ambeed | 100g | 2256.06 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 242.16 Pln | |
| BLDpharm | 25g | 753.09 Pln | |
| BLDpharm | 100g | 2424.73 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-(2,3-dichlorophenyl)propanoic acid (CAS 57915-79-4) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)propanoic acid. InChIKey: QJOCBCMKVRKWLM-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | QJOCBCMKVRKWLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CCC(=O)O |
Computed by PubChem (NCBI)