Products 57915-79-4
CAS 57915-79-4 appears in our catalog under these names: 3–(2，3–Dichlorophenyl)propanoic acid, 3-(2,3-Dichlorophenyl)propionic acid, 3-(2,3-Dichlorophenyl)propionic acid, 98%, 3-(2,3-Dichlorophenyl)propanoic acid, 97%, Benzenepropanoic acid, 2,3-dichloro-, 98%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 250mg, 100g, 50g.
3-(2,3-dichlorophenyl)propanoic acid (CAS 57915-79-4) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)propanoic acid. InChIKey: QJOCBCMKVRKWLM-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | QJOCBCMKVRKWLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CCC(=O)O |
Computed by PubChem (NCBI)