cas: 2950-82-5 — see every product listed under this CAS number, including other names
3-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)propanoic acid 98% (CAS 2950-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A863212-100mg |
| cas | 2950-82-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 2350.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A863212 |
3-(2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 2950-82-5) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-(2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: LREWQDQQBBUISJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-(2,4-dioxopyrimidin-1-yl)propanoic acid |
| InChIKey | LREWQDQQBBUISJ-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)NC1=O)CCC(=O)O |
Computed by PubChem (NCBI)