cas: 2950-82-5 — see every product listed under this CAS number, including other names
3-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)propanoic acid, 98%, 98% (CAS 2950-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113YKX-100mg |
| cas | 2950-82-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 2950-82-5) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-(2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: LREWQDQQBBUISJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-(2,4-dioxopyrimidin-1-yl)propanoic acid |
| InChIKey | LREWQDQQBBUISJ-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)NC1=O)CCC(=O)O |
Computed by PubChem (NCBI)