cas: 847264-30-6 — see every product listed under this CAS number, including other names
3-(2-Bromophenyl)pyridine (CAS 847264-30-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630934-250MG |
| cas | 847264-30-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1908.72 Pln |
| delivery time | 3-4 weeks |
|---|
3-(2-bromophenyl)pyridine (CAS 847264-30-6) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-(2-bromophenyl)pyridine. InChIKey: XEQMSSLGEYCVDC-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-(2-bromophenyl)pyridine |
| InChIKey | XEQMSSLGEYCVDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=CC=C2)Br |
Computed by PubChem (NCBI)