cas: 392-22-3 — see every product listed under this CAS number, including other names
3-(2-Chloro-6-fluorophenyl)acrylic acid 95% (E) (CAS 392-22-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A472842-5g |
| cas | 392-22-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 25g | 359.25 Pln |
| purity | 95% (E) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A472842 |
(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid (CAS 392-22-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid. InChIKey: NDWALECYVLNBQG-SNAWJCMRSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid |
| InChIKey | NDWALECYVLNBQG-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)