cas: 392-22-3 — see every product listed under this CAS number, including other names
2-Chloro-6-fluorocinnamic acid (CAS 392-22-3) is a chemical reagent available from Chemat. Available pack sizes: 10000mg, 1g, 5g, 25g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FC79506-10000mg |
| cas | 392-22-3 |
| size | 10000mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10000mg | price on request | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 25g | 351.98 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Sourcing |
| purity | No data |
| delivery time | 2-3 weeks |
(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid (CAS 392-22-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid. InChIKey: NDWALECYVLNBQG-SNAWJCMRSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid |
| InChIKey | NDWALECYVLNBQG-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)