cas: 104830-08-2 — see every product listed under this CAS number, including other names
3-(2-Chloro-pyridin-3-yl)-acrylic acid ethyl ester, 98%, 98% (CAS 104830-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I1N-100mg |
| cas | 104830-08-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 1432.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate (CAS 104830-08-2) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate. InChIKey: AXJQCHYUAHBXAK-AATRIKPKSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate |
| InChIKey | AXJQCHYUAHBXAK-AATRIKPKSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)