cas: 262608-88-8 — see every product listed under this CAS number, including other names
3-(2-Fluoro-4-(trifluoromethyl)phenyl)acrylic acid 97% (E) (CAS 262608-88-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A584185-100mg |
| cas | 262608-88-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 542.81 Pln |
| purity | 97% (E) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A584185 |
(E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 262608-88-8) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: (E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: HWBLGORXWYIISR-DUXPYHPUSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | (E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | HWBLGORXWYIISR-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)