CAS 575469-96-4 appears in our catalog under these names: 3-Fluoro-5-(trifluoromethyl)cinnamic acid, 95%, (E)-3-(3-Fluoro-5-(trifluoromethyl)phenyl)acrylic acid, 97%, 3-Fluoro-5-(trifluoromethyl)cinnamic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g.
(E)-3-[3-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 575469-96-4) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: (E)-3-[3-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: BALLIUNVQMPIFI-OWOJBTEDSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | (E)-3-[3-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | BALLIUNVQMPIFI-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)