Products 79538-02-6
CAS 79538-02-6 is the registry number for 4-Allyl-2,3,5,6-tetrafluorobenzoic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3,5,6-tetrafluoro-4-prop-2-enylbenzoic acid (CAS 79538-02-6) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-prop-2-enylbenzoic acid. InChIKey: INABVTWXXDFTOB-UHFFFAOYSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-prop-2-enylbenzoic acid |
| InChIKey | INABVTWXXDFTOB-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C(=C(C(=C1F)F)C(=O)O)F)F |
Computed by PubChem (NCBI)