CAS 247113-91-3 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethyl)cinnamic acid, 95%, 2-Fluoro-5-(trifluoromethyl)cinnamic acid, 97%+(LC-MS),RG, 97%+(LC-MS),RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
(E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 247113-91-3) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: (E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: AUPRFUNTWIUZEA-DAFODLJHSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | (E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | AUPRFUNTWIUZEA-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)