CAS 1184721-90-1 appears in our catalog under these names: (E)-3-(5-Fluoro-2-(trifluoromethyl)phenyl)acrylic acid, 95%, 5-Fluoro-2-(trifluoromethyl)cinnamic acid. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
(E)-3-[5-fluoro-2-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 1184721-90-1) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: (E)-3-[5-fluoro-2-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: LGTHHQOWFLXKQU-DAFODLJHSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | (E)-3-[5-fluoro-2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | LGTHHQOWFLXKQU-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1F)/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)