CAS 262608-88-8 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethyl)cinnamic acid, 95%, 3–(2–Fluoro–4–(trifluoromethyl)phenyl)acrylic acid, 3-(2-Fluoro-4-(trifluoromethyl)phenyl)acrylic acid 97% (E), 2-Fluoro-4-(trifluoromethyl)cinnamic acid, 98%, 98%, 3-(2-Fluoro-4-(trifluoromethyl)phenyl)acrylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
(E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 262608-88-8) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: (E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: HWBLGORXWYIISR-DUXPYHPUSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | (E)-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | HWBLGORXWYIISR-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)