cas: 160377-57-1 — see every product listed under this CAS number, including other names
3-(3-Bromophenyl)-5-methyl-1,2,4-oxadiazole, 97% (CAS 160377-57-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC39110CB |
| cas | 160377-57-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 67.20 Pln | |
| Thermo Scientific | 1g | 235.19 Pln | |
| Thermo Scientific | 5g | 921.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole (CAS 160377-57-1) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole. InChIKey: GTYLSVIVKRJHIQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole |
| InChIKey | GTYLSVIVKRJHIQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)