CAS 160377-57-1 appears in our catalog under these names: 3-(3-Bromophenyl)-5-methyl-1,2,4-oxadiazole, 98%, 3-(3-Bromophenyl)-5-methyl-1,2,4-oxadiazole, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole (CAS 160377-57-1) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole. InChIKey: GTYLSVIVKRJHIQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-(3-bromophenyl)-5-methyl-1,2,4-oxadiazole |
| InChIKey | GTYLSVIVKRJHIQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)