CAS 71566-07-9 appears in our catalog under these names: 5-(4-Bromophenyl)-3-methyl-1,2,4-oxadiazole, 98%, 5-(4-Bromophenyl)-3-methyl-1,2,4-oxadiazole, 5-(4-Bromophenyl)-3-methyl-1,2,4-oxadiazole, 97% . Offered by: Combi-blocks, TRC, AmBeed, Thermo Scientific. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg, 25g.
5-(4-bromophenyl)-3-methyl-1,2,4-oxadiazole (CAS 71566-07-9) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-(4-bromophenyl)-3-methyl-1,2,4-oxadiazole. InChIKey: AVXXUFMZRHQRTK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3-methyl-1,2,4-oxadiazole |
| InChIKey | AVXXUFMZRHQRTK-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)