CAS 121562-10-5 is the registry number for 5-Benzyl-3-bromo-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-benzyl-3-bromo-1,2,4-oxadiazole (CAS 121562-10-5) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-benzyl-3-bromo-1,2,4-oxadiazole. InChIKey: GVHVZTQUDZUSPB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-benzyl-3-bromo-1,2,4-oxadiazole |
| InChIKey | GVHVZTQUDZUSPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NO2)Br |
Computed by PubChem (NCBI)