Products 97267-63-5
CAS 97267-63-5 appears in our catalog under these names: 3-Bromo-8-methoxy-1,5-naphthyridine, 95%, 3-Bromo-8-methoxy-1,5-naphthyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-8-methoxy-1,5-naphthyridine (CAS 97267-63-5) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 3-bromo-8-methoxy-1,5-naphthyridine. InChIKey: XDIMNXCQMNDHRH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-bromo-8-methoxy-1,5-naphthyridine |
| InChIKey | XDIMNXCQMNDHRH-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=NC=C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)