CAS 1706749-51-0 appears in our catalog under these names: 4-Bromo-2-methyl-2,7-naphthyridin-1(2h)-one, 95%, 4-Bromo-2-methyl-1,2-dihydro-2,7-naphthyridin-1-one 97%, 4-Bromo-2-methyl-2,7-naphthyridin-1(2H)-one, 98%, 98%, 4-Bromo-2-methyl-2,7-naphthyridin-1(2H)-one, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
4-bromo-2-methyl-2,7-naphthyridin-1-one (CAS 1706749-51-0) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 4-bromo-2-methyl-2,7-naphthyridin-1-one. InChIKey: RSRQPUNBPIDFFJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 4-bromo-2-methyl-2,7-naphthyridin-1-one |
| InChIKey | RSRQPUNBPIDFFJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)C=NC=C2)Br |
Computed by PubChem (NCBI)