cas: 4422-32-6 — see every product listed under this CAS number, including other names
3-(3-Bromophenyl)pyridine 98% (CAS 4422-32-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109818-250mg |
| cas | 4422-32-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 25g | 1555.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109818 |
3-(3-bromophenyl)pyridine (CAS 4422-32-6) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-(3-bromophenyl)pyridine. InChIKey: JHUIVUBQMBPYJE-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-(3-bromophenyl)pyridine |
| InChIKey | JHUIVUBQMBPYJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CN=CC=C2 |
Computed by PubChem (NCBI)