cas: 90197-83-4 — see every product listed under this CAS number, including other names
3-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid, 95+% (CAS 90197-83-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A688925-10g |
| cas | 90197-83-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 5g | 6417.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (CAS 90197-83-4) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid. InChIKey: TWIDPXDENRHUJQ-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
| InChIKey | TWIDPXDENRHUJQ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CCC(=O)O)C |
Computed by PubChem (NCBI)