Products 1008961-08-7

CAS 1008961-08-7 is the registry number for (2,5-Dioxo-1-propyl-4-imidazolidinyl)acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,5-dioxo-1-propylimidazolidin-4-yl)acetic acid (CAS 1008961-08-7) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: 2-(2,5-dioxo-1-propylimidazolidin-4-yl)acetic acid. InChIKey: CGKIRIZAUWWJEN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O4
Molecular weight200.19 g/mol
IUPAC name2-(2,5-dioxo-1-propylimidazolidin-4-yl)acetic acid
InChIKeyCGKIRIZAUWWJEN-UHFFFAOYSA-N
SMILESCCCN1C(=O)C(NC1=O)CC(=O)O

Computed by PubChem (NCBI)