3-(4-Acetoxyphenyl)propanoic acid, 95%
cas: 7249-16-3 — see every product listed under this CAS number, including other names
3-(4-Acetoxyphenyl)propanoic acid, 95% (CAS 7249-16-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A858604-250mg |
| cas | 7249-16-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| Ambeed | 10g | 782.00 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 10g | 923.60 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 569.82 Pln | |
| BLDpharm | 10g | 841.95 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(4'-acetoxyphenyl)propionic acid is a monocarboxylic acid that is propionic acid substituted by a 4'-acetoxyphenyl group at position 3. It is a monocarboxylic acid and an acetate ester.
Source: ChEBI
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-(4-acetyloxyphenyl)propanoic acid |
| InChIKey | YQPHNMWXZLUIJX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-Acetoxyphenyl)propanoic acid, 3-[4-(acetyloxy)phenyl]propanoic acid, 3-(4-acetyloxyphenyl)propanoic acid, 4-Acetoxyhydrocinnamic acid, 3-(4'-acetoxyphenyl)propionic acid, Benzenepropanoic acid, 4-(acetyloxy)-, 3-(4-acetoxyphenyl)propionic acid, 3-(4-Acetoxyphenyl), bmse010065, ?-(4-Acetoxyphenyl)propionic acid