CAS 883-09-0 is the registry number for 5,7-Dihydroxy-2,2-dimethylchroman-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5,7-dihydroxy-2,2-dimethyl-3H-chromen-4-one (CAS 883-09-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 5,7-dihydroxy-2,2-dimethyl-3H-chromen-4-one. InChIKey: JFWGYKRUMPKNKF-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 5,7-dihydroxy-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | JFWGYKRUMPKNKF-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(C=C(C=C2O1)O)O)C |
Computed by PubChem (NCBI)