cas: 129013-83-8 — see every product listed under this CAS number, including other names
3-(4-Bromophenyl)pyridine, 97% (CAS 129013-83-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092724-1G |
| cas | 129013-83-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 732.05 Pln | |
| Fluorochem | 10g | 1388.07 Pln | |
| Fluorochem | 25g | 2252.35 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-(4-bromophenyl)pyridine (CAS 129013-83-8) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-(4-bromophenyl)pyridine. InChIKey: FCHUOBPHXDXZBK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-(4-bromophenyl)pyridine |
| InChIKey | FCHUOBPHXDXZBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)