cas: 65295-58-1 — see every product listed under this CAS number, including other names
3-(4-Fluorophenoxy)benzyl Bromide, >97.0%(GC) (CAS 65295-58-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0243-1G |
| cas | 65295-58-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 860.85 Pln | |
| TCI | 5g | 2950.68 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1-(bromomethyl)-3-(4-fluorophenoxy)benzene (CAS 65295-58-1) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-(bromomethyl)-3-(4-fluorophenoxy)benzene. InChIKey: JGFSTQUUDSBQCO-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(4-fluorophenoxy)benzene |
| InChIKey | JGFSTQUUDSBQCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)F)CBr |
Computed by PubChem (NCBI)