CAS 1082472-01-2 appears in our catalog under these names: 3-(4-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine, 95%, 95%, 3-(4-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine (CAS 1082472-01-2) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine. InChIKey: XRPOEIOBLVKRFT-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| InChIKey | XRPOEIOBLVKRFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C3N2C=C(C=C3)N)F |
Computed by PubChem (NCBI)