cas: 1736-21-6 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-5-methylisoxazole-4-carboxylic acid 98% (CAS 1736-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129811-1g |
| cas | 1736-21-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 10g | 770.88 Pln | |
| Ambeed | 25g | 1538.50 Pln | |
| Ambeed | 100g | 4508.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A129811 |
3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1736-21-6) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: PDEGBONVUJDOFN-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | PDEGBONVUJDOFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)