cas: 1736-21-6 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%, 98% (CAS 1736-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Z3H-1g |
| cas | 1736-21-6 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 630.80 Pln | |
| Chemat | 25g | 1250.00 Pln | |
| Chemat | 100g | 3664.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1736-21-6) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: PDEGBONVUJDOFN-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | PDEGBONVUJDOFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)