cas: 1736-21-6 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-5-methylisoxazole-4-carboxylic acid (CAS 1736-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222471-100MG |
| cas | 1736-21-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 1013.20 Pln |
| delivery time | 3-4 weeks |
|---|
3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1736-21-6) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: PDEGBONVUJDOFN-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | PDEGBONVUJDOFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)