cas: 19541-95-8 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)-1H-pyrazol-5-amine 98% (CAS 19541-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A561307-100mg |
| cas | 19541-95-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 364.81 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A561307 |
5-(4-methoxyphenyl)-1H-pyrazol-3-amine (CAS 19541-95-8) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1H-pyrazol-3-amine. InChIKey: UPAGEJODHNVJNM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1H-pyrazol-3-amine |
| InChIKey | UPAGEJODHNVJNM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NN2)N |
Computed by PubChem (NCBI)