cas: 935701-04-5 — see every product listed under this CAS number, including other names
3-(ACETOXYMETHYL)PHENYLBORONIC ACID, 98%, 98% (CAS 935701-04-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTE6-250mg |
| cas | 935701-04-5 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1202.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(acetyloxymethyl)phenyl]boronic acid (CAS 935701-04-5) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: [3-(acetyloxymethyl)phenyl]boronic acid. InChIKey: NCOMVLYGHIHVTP-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | [3-(acetyloxymethyl)phenyl]boronic acid |
| InChIKey | NCOMVLYGHIHVTP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC(=O)C)(O)O |
Computed by PubChem (NCBI)