cas: 23905-46-6 — see every product listed under this CAS number, including other names
3-(Acetylamino)benzenesulfonyl chloride, 95% (CAS 23905-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F308095-100MG |
| cas | 23905-46-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 1g | 1096.51 Pln | |
| Fluorochem | 5g | 3475.88 Pln | |
| Fluorochem | 10g | 6375.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-acetamidobenzenesulfonyl chloride (CAS 23905-46-6) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 3-acetamidobenzenesulfonyl chloride. InChIKey: BSNCGXHXSOEIEZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 3-acetamidobenzenesulfonyl chloride |
| InChIKey | BSNCGXHXSOEIEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)