cas: 23905-46-6 — see every product listed under this CAS number, including other names
3-Acetamidobenzene-1-sulfonyl chloride 98% (CAS 23905-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230343-100mg |
| cas | 23905-46-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 4508.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A230343 |
3-acetamidobenzenesulfonyl chloride (CAS 23905-46-6) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 3-acetamidobenzenesulfonyl chloride. InChIKey: BSNCGXHXSOEIEZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 3-acetamidobenzenesulfonyl chloride |
| InChIKey | BSNCGXHXSOEIEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)