cas: 1173081-96-3 — see every product listed under this CAS number, including other names
3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride, 98% (CAS 1173081-96-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238595-5G |
| cas | 1173081-96-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 299.91 Pln | |
| Fluorochem | 25g | 476.93 Pln | |
| Fluorochem | 50g | 737.26 Pln | |
| Fluorochem | 100g | 1263.11 Pln | |
| Fluorochem | 250g | 3074.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (CAS 1173081-96-3) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride. InChIKey: ZMDPNGUJHPRAMG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ZMDPNGUJHPRAMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)C.Cl |
Computed by PubChem (NCBI)