cas: 58452-00-9 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-4-methoxybenzoic acid 97% (CAS 58452-00-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A881104-1g |
| cas | 58452-00-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A881104 |
4-methoxy-3-phenylmethoxybenzoic acid (CAS 58452-00-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4-methoxy-3-phenylmethoxybenzoic acid. InChIKey: YPDXIGBSOBESNI-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-methoxy-3-phenylmethoxybenzoic acid |
| InChIKey | YPDXIGBSOBESNI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)