cas: 58452-00-9 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-4-methoxybenzoic acid, 98% (CAS 58452-00-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622184-5G |
| cas | 58452-00-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 846.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-methoxy-3-phenylmethoxybenzoic acid (CAS 58452-00-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4-methoxy-3-phenylmethoxybenzoic acid. InChIKey: YPDXIGBSOBESNI-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-methoxy-3-phenylmethoxybenzoic acid |
| InChIKey | YPDXIGBSOBESNI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)