cas: 58452-00-9 — see every product listed under this CAS number, including other names
3-(benzyloxy)-4-methoxybenzoic acid, 98%, 98% (CAS 58452-00-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IYS-50g |
| cas | 58452-00-9 |
| size | 50g |
| availability | 140g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1274.00 Pln | |
| Chemat | 100g | 2387.60 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-3-phenylmethoxybenzoic acid (CAS 58452-00-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4-methoxy-3-phenylmethoxybenzoic acid. InChIKey: YPDXIGBSOBESNI-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-methoxy-3-phenylmethoxybenzoic acid |
| InChIKey | YPDXIGBSOBESNI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)