3-(Difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxylic acid 98+%
cas: 1255735-09-1 — see every product listed under this CAS number, including other names
3-(Difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxylic acid 98+% (CAS 1255735-09-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116276-50mg |
| cas | 1255735-09-1 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1065.69 Pln | |
| Ambeed | 100mg | 1532.94 Pln | |
| Ambeed | 250mg | 2300.56 Pln | |
| Ambeed | 1g | 5387.75 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116276 |
3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid (CAS 1255735-09-1) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid. InChIKey: AXJCNOQHTJLWDH-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid |
| InChIKey | AXJCNOQHTJLWDH-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)F)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxylic acid, 3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxylic acid, 3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxylicacid, 3-(difluoromethyl)-5-fluoro-1-methyl-pyrazole-4-carboxylic acid, 3-difluoromethyl-5-fluoro-1-methyl-1H-pyrazole-4-carboxylic acid, 5-fluoro-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 1H-Pyrazole-4-carboxylic acid, 3-(difluoromethyl)-5-fluoro-1-methyl-