cas: 1211517-40-6 — see every product listed under this CAS number, including other names
3-(trifluoromethyl)-1H-pyrazolo(4,3-b)pyridine, 97% (CAS 1211517-40-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A666419-5g |
| cas | 1211517-40-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22503.46 Pln | |
| AmBeed | 1g | 7549.99 Pln | |
| AmBeed | 100mg | 1866.76 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine (CAS 1211517-40-6) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine. InChIKey: PVXRDHSMXOBFEC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine |
| InChIKey | PVXRDHSMXOBFEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2N=C1)C(F)(F)F |
Computed by PubChem (NCBI)