cas: 1072952-10-3 — see every product listed under this CAS number, including other names
3-AMINO-4,5-DIFLUOROPHENYLBORONIC ACID, 98%, 98% (CAS 1072952-10-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IV4-100mg |
| cas | 1072952-10-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 986.00 Pln | |
| Chemat | 250mg | 1019.60 Pln | |
| Chemat | 1g | 1974.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-amino-4,5-difluorophenyl)boronic acid (CAS 1072952-10-3) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: (3-amino-4,5-difluorophenyl)boronic acid. InChIKey: KPRHAVKMMVFSJB-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | (3-amino-4,5-difluorophenyl)boronic acid |
| InChIKey | KPRHAVKMMVFSJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)N)(O)O |
Computed by PubChem (NCBI)