Products 2096338-47-3
CAS 2096338-47-3 is the registry number for 6-Amino-2,3-difluorophenylboronic Acid, >95%, >95%. Offered by: Chemat. Available pack sizes: 250mg, 5g.
(6-amino-2,3-difluorophenyl)boronic acid (CAS 2096338-47-3) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: (6-amino-2,3-difluorophenyl)boronic acid. InChIKey: WJEMGBSVBSYHHO-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | (6-amino-2,3-difluorophenyl)boronic acid |
| InChIKey | WJEMGBSVBSYHHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)N)(O)O |
Computed by PubChem (NCBI)