CAS 1072952-14-7 appears in our catalog under these names: 2-Amino-4,5-difluorophenylboronic acid, 95%, (2-Amino-4,5-difluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
(2-amino-4,5-difluorophenyl)boronic acid (CAS 1072952-14-7) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: (2-amino-4,5-difluorophenyl)boronic acid. InChIKey: YDTCINIFZJCMSN-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | (2-amino-4,5-difluorophenyl)boronic acid |
| InChIKey | YDTCINIFZJCMSN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1N)F)F)(O)O |
Computed by PubChem (NCBI)