Products 1571135-77-7
CAS 1571135-77-7 appears in our catalog under these names: (2-(Difluoromethyl)pyridin-4-yl)boronic acid, 98%, (2-(Difluoromethyl)pyridin-4-yl)boronic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg.
[2-(difluoromethyl)-4-pyridinyl]boronic acid (CAS 1571135-77-7) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: [2-(difluoromethyl)-4-pyridinyl]boronic acid. InChIKey: PNRZIRAJNBYBRN-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | [2-(difluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | PNRZIRAJNBYBRN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(F)F)(O)O |
Computed by PubChem (NCBI)