CAS 1150114-58-1 is the registry number for 5-Amino-2,3-difluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(5-amino-2,3-difluorophenyl)boronic acid (CAS 1150114-58-1) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: (5-amino-2,3-difluorophenyl)boronic acid. InChIKey: SYFBUWWMOYGQOG-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | (5-amino-2,3-difluorophenyl)boronic acid |
| InChIKey | SYFBUWWMOYGQOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)N)(O)O |
Computed by PubChem (NCBI)