CAS 1072952-05-6 is the registry number for (5-Amino-2,4-difluorophenyl)boronic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-amino-2,4-difluorophenyl)boronic acid (CAS 1072952-05-6) is a chemical compound with the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. IUPAC name: (5-amino-2,4-difluorophenyl)boronic acid. InChIKey: OGNIKQBSICENMO-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO2 |
|---|---|
| Molecular weight | 172.93 g/mol |
| IUPAC name | (5-amino-2,4-difluorophenyl)boronic acid |
| InChIKey | OGNIKQBSICENMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)N)(O)O |
Computed by PubChem (NCBI)