cas: 202331-94-0 — see every product listed under this CAS number, including other names
3-Acetyl-6-methyl-4-phenylquinolin-2(1H)-one, 97% (CAS 202331-94-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A756505-5g |
| cas | 202331-94-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21396.76 Pln | |
| AmBeed | 10g | 29859.76 Pln | |
| AmBeed | 1g | 7178.92 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-acetyl-6-methyl-4-phenyl-1H-quinolin-2-one (CAS 202331-94-0) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 3-acetyl-6-methyl-4-phenyl-1H-quinolin-2-one. InChIKey: DCDUKTUZOFIPJE-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 3-acetyl-6-methyl-4-phenyl-1H-quinolin-2-one |
| InChIKey | DCDUKTUZOFIPJE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C(=C2C3=CC=CC=C3)C(=O)C |
Computed by PubChem (NCBI)