cas: 5452-39-1 — see every product listed under this CAS number, including other names
3-Acetyl-8-methoxy-2H-chromen-2-one, 95+%, 95+% (CAS 5452-39-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DASJ-100mg |
| cas | 5452-39-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1518.80 Pln | |
| Chemat | 10g | 2488.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3-acetyl-8-methoxychromen-2-one (CAS 5452-39-1) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 3-acetyl-8-methoxychromen-2-one. InChIKey: YZYLMMBZCXTXLW-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 3-acetyl-8-methoxychromen-2-one |
| InChIKey | YZYLMMBZCXTXLW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C(=CC=C2)OC)OC1=O |
Computed by PubChem (NCBI)