cas: 1255942-06-3 — see every product listed under this CAS number, including other names
3-Amino-1-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-1-propanone, 98%, 98% (CAS 1255942-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NX1-100mg |
| cas | 1255942-06-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2474.00 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 25g | 7139.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one (CAS 1255942-06-3) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one. InChIKey: OCCYFTDHSHTFER-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one |
| InChIKey | OCCYFTDHSHTFER-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCN |
Computed by PubChem (NCBI)